| Identification | |
|---|---|
| Name | N,N-Bis(4-Chlorobenzyl)-1h-1,2,3,4-Tetraazol-5-Amine |
| Accession Number | DB04037 (EXPT00852) |
| Type | small molecule |
| Description | Not Available |
| Structure |
|
| Categories (*) | |
| Molecular Weight | 334.203 |
| Groups | experimental |
| Monoisotopic Weight | 333.054800855 |
| Pharmacology | |
| Indication | Not Available |
| Mechanism of action | Not Available |
| Absorption | Not Available |
| Protein binding | Not Available |
| Biotransformation | Not Available |
| Route of elimination | Not Available |
| Toxicity | Not Available |
| Affected organisms | Not Available |
| Interactions | |
| Drug Interactions | Not Available |
| Food Interactions | Not Available |
| Beta-lactamase TEM | |
|---|---|
| Name | Beta-lactamase TEM |
| Gene Name | bla |
| Pharmacological action | unknown |
| Actions | Not Available |
| References | |
| DTHybrid score | 1.4066 |
| Beta-lactamase TEM | |
| Name | Beta-lactamase TEM |
| Gene Name | bla |
| Pharmacological action | unknown |
| Actions | Not Available |
| References |
|
| DTHybrid score | 1.4066 |
| Id | Partner name | Gene Name | Score |
|---|---|---|---|
| 4629 | Beta-lactamase CTX-M-9a | blaCTX-M-9a | 0.186 |
| 332 | Beta-lactamase | blaZ | 0.1254 |
| 2478 | Beta-lactamase | ampC | 0.1254 |
| 2613 | Beta-lactamase | ampC | 0.1254 |
| 2635 | Beta-lactamase | ampC | 0.1254 |
| 2700 | Beta-lactamase | penP | 0.1254 |
| 5445 | Beta-lactamase | blaB | 0.1254 |
| 6019 | Beta-lactamase | SHV-7 | 0.1254 |
| 6701 | Beta-lactamase | cphA | 0.1254 |
| 3687 | Beta-lactamase SHV-1 precursor | bla | 0.1165 |
| 4812 | Extended-spectrum beta-lactamase CTX-M-14 | blaCTX-M-14 | 0.0787 |